About N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide
N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide (PubChem CID 124864238) has the molecular formula C15H27N3O2
and a molecular weight of 281.40 g/mol. Its IUPAC name is N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide |
| PubChem CID | 124864238 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide |
| SMILES | CC[C@H](C)[C@H](CO)NC(=O)c1cc(CCC(C)C)[nH]n1 |
| InChI | InChI=1S/C15H27N3O2/c1-5-11(4)14(9-19)16-15(20)13-8-12(17-18-13)7-6-10(2)3/h8,10-11,14,19H,5-7,9H2,1-4H3,(H,16,20)(H,17,18)/t11-,14-/m0/s1 |
| InChIKey | XEWPJZFLSAIRKA-FZMZJTMJSA-N |
| XLogP | 2.14 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide?
The IUPAC name of N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide (CID 124864238) is N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide.
What is the SMILES notation for N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide?
The canonical SMILES for N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide is CC[C@H](C)[C@H](CO)NC(=O)c1cc(CCC(C)C)[nH]n1.
What is the InChIKey of N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide?
The InChIKey is XEWPJZFLSAIRKA-FZMZJTMJSA-N. The full InChI is InChI=1S/C15H27N3O2/c1-5-11(4)14(9-19)16-15(20)13-8-12(17-18-13)7-6-10(2)3/h8,10-11,14,19H,5-7,9H2,1-4H3,(H,16,20)(H,17,18)/t11-,14-/m0/s1.
What are the key properties of N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide?
N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide has a molecular weight of 281.40 g/mol, XLogP of 2.14, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3S)-1-hydroxy-3-methylpentan-2-yl]-5-(3-methylbutyl)-1H-pyrazole-3-carboxamide is sourced from PubChem (CID 124864238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).