C20H26N2O — CID 124864491
(2R)-2-amino-N-(2,3,4,5,6-pentamethylphenyl)-3-phenylpropanamide (PubChem CID 124864491) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is (2R)-2-amino-N-(2,3,4,5,6-pentamethylphenyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-amino-N-(2,3,4,5,6-pentamethylphenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 124864491 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (2R)-2-amino-N-(2,3,4,5,6-pentamethylphenyl)-3-phenylpropanamide |
| SMILES | Cc1c(C)c(C)c(NC(=O)[C@H](N)Cc2ccccc2)c(C)c1C |
| InChI | InChI=1S/C20H26N2O/c1-12-13(2)15(4)19(16(5)14(12)3)22-20(23)18(21)11-17-9-7-6-8-10-17/h6-10,18H,11,21H2,1-5H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | YNPZLWGTAJCPTQ-GOSISDBHSA-N |
| XLogP | 3.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |