C20H21N3O3 — CID 124865201
(1R,2R,3R,4R)-3-[[(1S)-1-(3-pyrazol-1-ylphenyl)ethyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 124865201) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3-[[(1S)-1-(3-pyrazol-1-ylphenyl)ethyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-3-[[(1S)-1-(3-pyrazol-1-ylphenyl)ethyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 124865201 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (1R,2R,3R,4R)-3-[[(1S)-1-(3-pyrazol-1-ylphenyl)ethyl]carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | C[C@H](NC(=O)[C@H]1[C@H](C(=O)O)[C@H]2C=C[C@H]1C2)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-12(13-4-2-5-16(11-13)23-9-3-8-21-23)22-19(24)17-14-6-7-15(10-14)18(17)20(25)26/h2-9,11-12,14-15,17-18H,10H2,1H3,(H,22,24)(H,25,26)/t12-,14-,15-,17+,18+/m0/s1 |
| InChIKey | YYPNRTHKQAERHH-LZDZAVHKSA-N |
| XLogP | 2.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|