C13H24N6 — CID 124865228
N'-[3-[[(1R,3R,4R)-3,4-dimethylcyclohexyl]amino]-1H-1,2,4-triazol-5-yl]-N,N-dimethylmethanimidamide (PubChem CID 124865228) has the molecular formula C13H24N6 and a molecular weight of 264.38 g/mol. Its IUPAC name is N'-[3-[[(1R,3R,4R)-3,4-dimethylcyclohexyl]amino]-1H-1,2,4-triazol-5-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[3-[[(1R,3R,4R)-3,4-dimethylcyclohexyl]amino]-1H-1,2,4-triazol-5-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 124865228 |
| Molecular Formula | C13H24N6 |
| Molecular Weight | 264.38 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | N'-[3-[[(1R,3R,4R)-3,4-dimethylcyclohexyl]amino]-1H-1,2,4-triazol-5-yl]-N,N-dimethylmethanimidamide |
| SMILES | C[C@@H]1CC[C@@H](Nc2n[nH]c(N=CN(C)C)n2)C[C@H]1C |
| InChI | InChI=1S/C13H24N6/c1-9-5-6-11(7-10(9)2)15-13-16-12(17-18-13)14-8-19(3)4/h8-11H,5-7H2,1-4H3,(H2,15,16,17,18)/t9-,10-,11-/m1/s1 |
| InChIKey | ZWHQCCGYZKFVLV-GMTAPVOTSA-N |
| XLogP | 2.26 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|