C24H37NO — CID 124865263
dicyclohexyl-[(2S)-1-[(1R)-1-phenylethyl]azetidin-2-yl]methanol (PubChem CID 124865263) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is dicyclohexyl-[(2S)-1-[(1R)-1-phenylethyl]azetidin-2-yl]methanol.
| Compound Name | dicyclohexyl-[(2S)-1-[(1R)-1-phenylethyl]azetidin-2-yl]methanol |
|---|---|
| PubChem CID | 124865263 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | dicyclohexyl-[(2S)-1-[(1R)-1-phenylethyl]azetidin-2-yl]methanol |
| SMILES | C[C@H](c1ccccc1)N1CC[C@H]1C(O)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H37NO/c1-19(20-11-5-2-6-12-20)25-18-17-23(25)24(26,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2,5-6,11-12,19,21-23,26H,3-4,7-10,13-18H2,1H3/t19-,23+/m1/s1 |
| InChIKey | CKNQGYBCGDCJJQ-XXBNENTESA-N |
| XLogP | 5.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |