C21H30N2O3 — CID 124866664
(3R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-(4-methylphenyl)-2-oxopyrrolidine-3-carboxamide (PubChem CID 124866664) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (3R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-(4-methylphenyl)-2-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-(4-methylphenyl)-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 124866664 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (3R)-N-[2-[(1R,2R)-2-methylcyclohexyl]oxyethyl]-1-(4-methylphenyl)-2-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(N2CC[C@H](C(=O)NCCO[C@@H]3CCCC[C@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C21H30N2O3/c1-15-7-9-17(10-8-15)23-13-11-18(21(23)25)20(24)22-12-14-26-19-6-4-3-5-16(19)2/h7-10,16,18-19H,3-6,11-14H2,1-2H3,(H,22,24)/t16-,18-,19-/m1/s1 |
| InChIKey | FFCWRVVKMTZFJP-BHIYHBOVSA-N |
| XLogP | 3.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|