C19H21N3OS — CID 124866876
(E)-1-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-(1,3-thiazol-2-yl)prop-2-en-1-one (PubChem CID 124866876) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is (E)-1-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-(1,3-thiazol-2-yl)prop-2-en-1-one.
| Compound Name | (E)-1-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-(1,3-thiazol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 124866876 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | (E)-1-[(4aR,9bS)-2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl]-3-(1,3-thiazol-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc2c(c1)[C@H]1CN(C)CC[C@H]1N2C(=O)/C=C/c1nccs1 |
| InChI | InChI=1S/C19H21N3OS/c1-13-3-4-16-14(11-13)15-12-21(2)9-7-17(15)22(16)19(23)6-5-18-20-8-10-24-18/h3-6,8,10-11,15,17H,7,9,12H2,1-2H3/b6-5+/t15-,17-/m1/s1 |
| InChIKey | MUWCCCYSHLUKHG-AMFYOEQGSA-N |
| XLogP | 3.30 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|