C29H49BrO — CID 124867557
(3S,5S,8R,9R,10R,13R,14R,17S)-3-bromo-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one (PubChem CID 124867557) has the molecular formula C29H49BrO and a molecular weight of 493.61 g/mol. Its IUPAC name is (3S,5S,8R,9R,10R,13R,14R,17S)-3-bromo-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | (3S,5S,8R,9R,10R,13R,14R,17S)-3-bromo-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 124867557 |
| Molecular Formula | C29H49BrO |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | (3S,5S,8R,9R,10R,13R,14R,17S)-3-bromo-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| SMILES | CC[C@H](CC[C@@H](C)[C@@H]1CC[C@@H]2[C@H]3CC(=O)[C@H]4C[C@@H](Br)CC[C@]4(C)[C@@H]3CC[C@@]21C)C(C)C |
| InChI | InChI=1S/C29H49BrO/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-22-17-27(31)26-16-21(30)12-14-29(26,6)25(22)13-15-28(23,24)5/h18-26H,7-17H2,1-6H3/t19-,20-,21+,22-,23+,24-,25-,26-,28-,29-/m1/s1 |
| InChIKey | KBSDBYDTKXUZDW-FYNIESJSSA-N |
| XLogP | 8.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|