C16H21ClO6 — CID 124869683
(2S,3R,4R)-5-(4-chloro-3,5-dimethylphenoxy)-3-hydroxy-2-(hydroxymethyl)-2,4-dimethyl-5-oxopentanoic acid (PubChem CID 124869683) has the molecular formula C16H21ClO6 and a molecular weight of 344.79 g/mol. Its IUPAC name is (2S,3R,4R)-5-(4-chloro-3,5-dimethylphenoxy)-3-hydroxy-2-(hydroxymethyl)-2,4-dimethyl-5-oxopentanoic acid.
| Compound Name | (2S,3R,4R)-5-(4-chloro-3,5-dimethylphenoxy)-3-hydroxy-2-(hydroxymethyl)-2,4-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 124869683 |
| Molecular Formula | C16H21ClO6 |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (2S,3R,4R)-5-(4-chloro-3,5-dimethylphenoxy)-3-hydroxy-2-(hydroxymethyl)-2,4-dimethyl-5-oxopentanoic acid |
| SMILES | Cc1cc(OC(=O)[C@H](C)[C@@H](O)[C@](C)(CO)C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C16H21ClO6/c1-8-5-11(6-9(2)12(8)17)23-14(20)10(3)13(19)16(4,7-18)15(21)22/h5-6,10,13,18-19H,7H2,1-4H3,(H,21,22)/t10-,13-,16+/m1/s1 |
| InChIKey | XRWNNYSQAUNBGV-ZXIHIIQKSA-N |
| XLogP | 1.94 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|