C17H28N4O2 — CID 124872092
2-methyl-1-[(3R)-3-(1-methylimidazol-2-yl)piperidin-1-yl]-2-morpholin-4-ylpropan-1-one (PubChem CID 124872092) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-methyl-1-[(3R)-3-(1-methylimidazol-2-yl)piperidin-1-yl]-2-morpholin-4-ylpropan-1-one.
| Compound Name | 2-methyl-1-[(3R)-3-(1-methylimidazol-2-yl)piperidin-1-yl]-2-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 124872092 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-methyl-1-[(3R)-3-(1-methylimidazol-2-yl)piperidin-1-yl]-2-morpholin-4-ylpropan-1-one |
| SMILES | Cn1ccnc1[C@@H]1CCCN(C(=O)C(C)(C)N2CCOCC2)C1 |
| InChI | InChI=1S/C17H28N4O2/c1-17(2,21-9-11-23-12-10-21)16(22)20-7-4-5-14(13-20)15-18-6-8-19(15)3/h6,8,14H,4-5,7,9-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | CFGHPARTTXPVBY-CQSZACIVSA-N |
| XLogP | 1.24 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |