C17H15FN2OS — CID 124872171
N-[(4S)-2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]but-2-ynamide (PubChem CID 124872171) has the molecular formula C17H15FN2OS and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[(4S)-2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]but-2-ynamide.
| Compound Name | N-[(4S)-2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]but-2-ynamide |
|---|---|
| PubChem CID | 124872171 |
| Molecular Formula | C17H15FN2OS |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-[(4S)-2-(4-fluorophenyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]but-2-ynamide |
| SMILES | CC#CC(=O)N[C@H]1CCCc2sc(-c3ccc(F)cc3)nc21 |
| InChI | InChI=1S/C17H15FN2OS/c1-2-4-15(21)19-13-5-3-6-14-16(13)20-17(22-14)11-7-9-12(18)10-8-11/h7-10,13H,3,5-6H2,1H3,(H,19,21)/t13-/m0/s1 |
| InChIKey | VNEROUVWNKVJMU-ZDUSSCGKSA-N |
| XLogP | 3.47 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|