C18H24N2O4 — CID 124872476
methyl (2S,3aR,5R,7aR)-5-methyl-4-[2-(6-methyl-3-pyridinyl)acetyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate (PubChem CID 124872476) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is methyl (2S,3aR,5R,7aR)-5-methyl-4-[2-(6-methyl-3-pyridinyl)acetyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate.
| Compound Name | methyl (2S,3aR,5R,7aR)-5-methyl-4-[2-(6-methyl-3-pyridinyl)acetyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 124872476 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | methyl (2S,3aR,5R,7aR)-5-methyl-4-[2-(6-methyl-3-pyridinyl)acetyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2[C@@H](CC[C@@H](C)N2C(=O)Cc2ccc(C)nc2)O1 |
| InChI | InChI=1S/C18H24N2O4/c1-11-4-6-13(10-19-11)8-17(21)20-12(2)5-7-15-14(20)9-16(24-15)18(22)23-3/h4,6,10,12,14-16H,5,7-9H2,1-3H3/t12-,14-,15-,16+/m1/s1 |
| InChIKey | RJPMXCZGAFPYBB-MIGQKNRLSA-N |
| XLogP | 1.64 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |