C19H16N2O5S2 — CID 124873818
N'-(1,3-benzodioxol-5-yl)-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]oxamide (PubChem CID 124873818) has the molecular formula C19H16N2O5S2 and a molecular weight of 416.48 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-yl)-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]oxamide.
| Compound Name | N'-(1,3-benzodioxol-5-yl)-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 124873818 |
| Molecular Formula | C19H16N2O5S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | N'-(1,3-benzodioxol-5-yl)-N-[(2S)-2-hydroxy-2-thiophen-2-yl-2-thiophen-3-ylethyl]oxamide |
| SMILES | O=C(NC[C@@](O)(c1ccsc1)c1cccs1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16N2O5S2/c22-17(18(23)21-13-3-4-14-15(8-13)26-11-25-14)20-10-19(24,12-5-7-27-9-12)16-2-1-6-28-16/h1-9,24H,10-11H2,(H,20,22)(H,21,23)/t19-/m1/s1 |
| InChIKey | BQEBKZBCDNFMBL-LJQANCHMSA-N |
| XLogP | 2.53 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|