C12H10N6O2S — CID 124873848
5-nitro-N-[(R)-phenyl(1H-1,2,4-triazol-5-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 124873848) has the molecular formula C12H10N6O2S and a molecular weight of 302.32 g/mol. Its IUPAC name is 5-nitro-N-[(R)-phenyl(1H-1,2,4-triazol-5-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | 5-nitro-N-[(R)-phenyl(1H-1,2,4-triazol-5-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 124873848 |
| Molecular Formula | C12H10N6O2S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-nitro-N-[(R)-phenyl(1H-1,2,4-triazol-5-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cnc(N[C@H](c2ccccc2)c2ncn[nH]2)s1 |
| InChI | InChI=1S/C12H10N6O2S/c19-18(20)9-6-13-12(21-9)16-10(11-14-7-15-17-11)8-4-2-1-3-5-8/h1-7,10H,(H,13,16)(H,14,15,17)/t10-/m1/s1 |
| InChIKey | OTHZBUAZRQVJFZ-SNVBAGLBSA-N |
| XLogP | 2.37 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|