About (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide
(2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide (PubChem CID 124874127) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide.
Molecular Properties
| Compound Name | (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide |
| PubChem CID | 124874127 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide |
| SMILES | CCCC[C@H](C)C(=O)N(C)c1cc(C#N)ccn1 |
| InChI | InChI=1S/C14H19N3O/c1-4-5-6-11(2)14(18)17(3)13-9-12(10-15)7-8-16-13/h7-9,11H,4-6H2,1-3H3/t11-/m0/s1 |
| InChIKey | VCKCZICHWAGNKY-NSHDSACASA-N |
| XLogP | 2.74 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide?
The IUPAC name of (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide (CID 124874127) is (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide.
What is the SMILES notation for (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide?
The canonical SMILES for (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide is CCCC[C@H](C)C(=O)N(C)c1cc(C#N)ccn1.
What is the InChIKey of (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide?
The InChIKey is VCKCZICHWAGNKY-NSHDSACASA-N. The full InChI is InChI=1S/C14H19N3O/c1-4-5-6-11(2)14(18)17(3)13-9-12(10-15)7-8-16-13/h7-9,11H,4-6H2,1-3H3/t11-/m0/s1.
What are the key properties of (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide?
(2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide has a molecular weight of 245.33 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(4-cyano-2-pyridinyl)-N,2-dimethylhexanamide is sourced from PubChem (CID 124874127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).