C14H21N5O2S — CID 124874688
(5S,9S)-9-[[[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 124874688) has the molecular formula C14H21N5O2S and a molecular weight of 323.42 g/mol. Its IUPAC name is (5S,9S)-9-[[[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5S,9S)-9-[[[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 124874688 |
| Molecular Formula | C14H21N5O2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (5S,9S)-9-[[[3-(2-methylpropyl)-1,2,4-thiadiazol-5-yl]amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC(C)Cc1nsc(NC[C@@H]2CCC[C@]23NC(=O)NC3=O)n1 |
| InChI | InChI=1S/C14H21N5O2S/c1-8(2)6-10-16-13(22-19-10)15-7-9-4-3-5-14(9)11(20)17-12(21)18-14/h8-9H,3-7H2,1-2H3,(H,15,16,19)(H2,17,18,20,21)/t9-,14-/m0/s1 |
| InChIKey | UIRCOGJQECFLJL-XPTSAGLGSA-N |
| XLogP | 1.53 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|