C17H21FN4O3 — CID 124874715
methyl 1-[(3R)-1-[(2-fluoro-3-methoxyphenyl)methyl]piperidin-3-yl]triazole-4-carboxylate (PubChem CID 124874715) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is methyl 1-[(3R)-1-[(2-fluoro-3-methoxyphenyl)methyl]piperidin-3-yl]triazole-4-carboxylate.
| Compound Name | methyl 1-[(3R)-1-[(2-fluoro-3-methoxyphenyl)methyl]piperidin-3-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 124874715 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | methyl 1-[(3R)-1-[(2-fluoro-3-methoxyphenyl)methyl]piperidin-3-yl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn([C@@H]2CCCN(Cc3cccc(OC)c3F)C2)nn1 |
| InChI | InChI=1S/C17H21FN4O3/c1-24-15-7-3-5-12(16(15)18)9-21-8-4-6-13(10-21)22-11-14(19-20-22)17(23)25-2/h3,5,7,11,13H,4,6,8-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | FKUPLRVEYPGNLK-CYBMUJFWSA-N |
| XLogP | 2.05 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |