C15H28N4O3S — CID 124874935
(2R)-N-[(2R)-2-cyanopropyl]-N-methyl-2-(morpholin-4-ylmethyl)piperidine-1-sulfonamide (PubChem CID 124874935) has the molecular formula C15H28N4O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is (2R)-N-[(2R)-2-cyanopropyl]-N-methyl-2-(morpholin-4-ylmethyl)piperidine-1-sulfonamide.
| Compound Name | (2R)-N-[(2R)-2-cyanopropyl]-N-methyl-2-(morpholin-4-ylmethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 124874935 |
| Molecular Formula | C15H28N4O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (2R)-N-[(2R)-2-cyanopropyl]-N-methyl-2-(morpholin-4-ylmethyl)piperidine-1-sulfonamide |
| SMILES | C[C@@H](C#N)CN(C)S(=O)(=O)N1CCCC[C@@H]1CN1CCOCC1 |
| InChI | InChI=1S/C15H28N4O3S/c1-14(11-16)12-17(2)23(20,21)19-6-4-3-5-15(19)13-18-7-9-22-10-8-18/h14-15H,3-10,12-13H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | CNBXGZQONSNCHF-LSDHHAIUSA-N |
| XLogP | 0.51 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |