C17H14ClF3N2O4 — CID 124875222
5-chloro-6-[(3S)-oxolan-3-yl]oxy-N-[2-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 124875222) has the molecular formula C17H14ClF3N2O4 and a molecular weight of 402.76 g/mol. Its IUPAC name is 5-chloro-6-[(3S)-oxolan-3-yl]oxy-N-[2-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[(3S)-oxolan-3-yl]oxy-N-[2-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124875222 |
| Molecular Formula | C17H14ClF3N2O4 |
| Molecular Weight | 402.76 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 5-chloro-6-[(3S)-oxolan-3-yl]oxy-N-[2-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)c1cnc(O[C@H]2CCOC2)c(Cl)c1 |
| InChI | InChI=1S/C17H14ClF3N2O4/c18-12-7-10(8-22-16(12)26-11-5-6-25-9-11)15(24)23-13-3-1-2-4-14(13)27-17(19,20)21/h1-4,7-8,11H,5-6,9H2,(H,23,24)/t11-/m0/s1 |
| InChIKey | GKPASEANYBXJEZ-NSHDSACASA-N |
| XLogP | 4.05 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.76 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |