C14H22N2O4S — CID 124875226
N-[4-[[(2S)-2-methoxypropyl]sulfonylamino]phenyl]-2-methylpropanamide (PubChem CID 124875226) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-[4-[[(2S)-2-methoxypropyl]sulfonylamino]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-[[(2S)-2-methoxypropyl]sulfonylamino]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 124875226 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-[4-[[(2S)-2-methoxypropyl]sulfonylamino]phenyl]-2-methylpropanamide |
| SMILES | CO[C@@H](C)CS(=O)(=O)Nc1ccc(NC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C14H22N2O4S/c1-10(2)14(17)15-12-5-7-13(8-6-12)16-21(18,19)9-11(3)20-4/h5-8,10-11,16H,9H2,1-4H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | KCFPTIQMFCXYEE-NSHDSACASA-N |
| XLogP | 2.06 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |