C13H24N2O3 — CID 124875447
(4aS,8aS)-6-[2-(2-methylpropoxy)ethyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 124875447) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is (4aS,8aS)-6-[2-(2-methylpropoxy)ethyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aS,8aS)-6-[2-(2-methylpropoxy)ethyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 124875447 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | (4aS,8aS)-6-[2-(2-methylpropoxy)ethyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | CC(C)COCCN1CC[C@@H]2OCC(=O)N[C@H]2C1 |
| InChI | InChI=1S/C13H24N2O3/c1-10(2)8-17-6-5-15-4-3-12-11(7-15)14-13(16)9-18-12/h10-12H,3-9H2,1-2H3,(H,14,16)/t11-,12-/m0/s1 |
| InChIKey | QUQJPSSGSHAIFK-RYUDHWBXSA-N |
| XLogP | 0.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|