C22H34N2O3S — CID 124877939
N-[(Z)-[(2R,4aS,5R,8R,8aS)-4a-hydroxy-2,5-dimethyl-8-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 124877939) has the molecular formula C22H34N2O3S and a molecular weight of 406.59 g/mol. Its IUPAC name is N-[(Z)-[(2R,4aS,5R,8R,8aS)-4a-hydroxy-2,5-dimethyl-8-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-[(2R,4aS,5R,8R,8aS)-4a-hydroxy-2,5-dimethyl-8-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 124877939 |
| Molecular Formula | C22H34N2O3S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | N-[(Z)-[(2R,4aS,5R,8R,8aS)-4a-hydroxy-2,5-dimethyl-8-propan-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-ylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=C2[C@H](C)CC[C@]3(O)[C@H](C)CC[C@H](C(C)C)[C@@H]23)cc1 |
| InChI | InChI=1S/C22H34N2O3S/c1-14(2)19-11-8-17(5)22(25)13-12-16(4)21(20(19)22)23-24-28(26,27)18-9-6-15(3)7-10-18/h6-7,9-10,14,16-17,19-20,24-25H,8,11-13H2,1-5H3/t16-,17-,19-,20+,22+/m1/s1 |
| InChIKey | VUGGHMZYUWKQCY-CYVQNBIGSA-N |
| XLogP | 4.11 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|