C18H22N2O4 — CID 124878229
N-(furan-2-ylmethyl)-N'-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]oxamide (PubChem CID 124878229) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]oxamide |
|---|---|
| PubChem CID | 124878229 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[(1R)-1-(4-methoxyphenyl)-2-methylpropyl]oxamide |
| SMILES | COc1ccc([C@H](NC(=O)C(=O)NCc2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C18H22N2O4/c1-12(2)16(13-6-8-14(23-3)9-7-13)20-18(22)17(21)19-11-15-5-4-10-24-15/h4-10,12,16H,11H2,1-3H3,(H,19,21)(H,20,22)/t16-/m1/s1 |
| InChIKey | TUZUPYZUDYLSKE-MRXNPFEDSA-N |
| XLogP | 2.42 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|