C18H19F3N2O2S — CID 124878574
N-[(2R)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]-4-(trifluoromethyl)benzamide (PubChem CID 124878574) has the molecular formula C18H19F3N2O2S and a molecular weight of 384.42 g/mol. Its IUPAC name is N-[(2R)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(2R)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 124878574 |
| Molecular Formula | C18H19F3N2O2S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[(2R)-2-(furan-2-yl)-2-thiomorpholin-4-ylethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NC[C@H](c1ccco1)N1CCSCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O2S/c19-18(20,21)14-5-3-13(4-6-14)17(24)22-12-15(16-2-1-9-25-16)23-7-10-26-11-8-23/h1-6,9,15H,7-8,10-12H2,(H,22,24)/t15-/m1/s1 |
| InChIKey | ZOAYPHTYGVLSEN-OAHLLOKOSA-N |
| XLogP | 3.82 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |