C20H21F3N2O4 — CID 124878702
(3S)-3-[3-hydroxy-4-oxo-6-(piperidin-1-ylmethyl)pyran-2-yl]-3-(3,4,5-trifluorophenyl)propanamide (PubChem CID 124878702) has the molecular formula C20H21F3N2O4 and a molecular weight of 410.39 g/mol. Its IUPAC name is (3S)-3-[3-hydroxy-4-oxo-6-(piperidin-1-ylmethyl)pyran-2-yl]-3-(3,4,5-trifluorophenyl)propanamide.
| Compound Name | (3S)-3-[3-hydroxy-4-oxo-6-(piperidin-1-ylmethyl)pyran-2-yl]-3-(3,4,5-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 124878702 |
| Molecular Formula | C20H21F3N2O4 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (3S)-3-[3-hydroxy-4-oxo-6-(piperidin-1-ylmethyl)pyran-2-yl]-3-(3,4,5-trifluorophenyl)propanamide |
| SMILES | NC(=O)C[C@@H](c1cc(F)c(F)c(F)c1)c1oc(CN2CCCCC2)cc(=O)c1O |
| InChI | InChI=1S/C20H21F3N2O4/c21-14-6-11(7-15(22)18(14)23)13(9-17(24)27)20-19(28)16(26)8-12(29-20)10-25-4-2-1-3-5-25/h6-8,13,28H,1-5,9-10H2,(H2,24,27)/t13-/m0/s1 |
| InChIKey | MIIVGOIVTHTSMS-ZDUSSCGKSA-N |
| XLogP | 2.76 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|