C26H27N3O4 — CID 124879639
6-[3-[(2R)-2-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one (PubChem CID 124879639) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 6-[3-[(2R)-2-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one.
| Compound Name | 6-[3-[(2R)-2-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 124879639 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 6-[3-[(2R)-2-(1H-benzimidazol-2-yl)piperidin-1-yl]-3-oxopropyl]-7-methoxy-4-methylchromen-2-one |
| SMILES | COc1cc2oc(=O)cc(C)c2cc1CCC(=O)N1CCCC[C@@H]1c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C26H27N3O4/c1-16-13-25(31)33-23-15-22(32-2)17(14-18(16)23)10-11-24(30)29-12-6-5-9-21(29)26-27-19-7-3-4-8-20(19)28-26/h3-4,7-8,13-15,21H,5-6,9-12H2,1-2H3,(H,27,28)/t21-/m1/s1 |
| InChIKey | VBGJIUSOTGNPAO-OAQYLSRUSA-N |
| XLogP | 4.67 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|