C14H22N6 — CID 124880293
trans-(1S,3S)-1-N,1-N-dimethyl-3-N-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)cyclohexane-1,3-diamine (PubChem CID 124880293) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is trans-(1S,3S)-1-N,1-N-dimethyl-3-N-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)cyclohexane-1,3-diamine.
| Compound Name | trans-(1S,3S)-1-N,1-N-dimethyl-3-N-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 124880293 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | trans-(1S,3S)-1-N,1-N-dimethyl-3-N-(2-methyl-[1,2,4]triazolo[1,5-b]pyridazin-6-yl)cyclohexane-1,3-diamine |
| SMILES | Cc1nc2ccc(N[C@H]3CCC[C@H](N(C)C)C3)nn2n1 |
| InChI | InChI=1S/C14H22N6/c1-10-15-14-8-7-13(18-20(14)17-10)16-11-5-4-6-12(9-11)19(2)3/h7-8,11-12H,4-6,9H2,1-3H3,(H,16,18)/t11-,12-/m0/s1 |
| InChIKey | CPSQSWZENXNGCP-RYUDHWBXSA-N |
| XLogP | 1.72 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |