C18H24ClN5 — CID 124880355
(6R)-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 124880355) has the molecular formula C18H24ClN5 and a molecular weight of 345.88 g/mol. Its IUPAC name is (6R)-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
| Compound Name | (6R)-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 124880355 |
| Molecular Formula | C18H24ClN5 |
| Molecular Weight | 345.88 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (6R)-N-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-amine |
| SMILES | Clc1ccc(CN2CCC(N[C@@H]3CCc4ncnn4C3)CC2)cc1 |
| InChI | InChI=1S/C18H24ClN5/c19-15-3-1-14(2-4-15)11-23-9-7-16(8-10-23)22-17-5-6-18-20-13-21-24(18)12-17/h1-4,13,16-17,22H,5-12H2/t17-/m1/s1 |
| InChIKey | CQMYUAKMFIZNGH-QGZVFWFLSA-N |
| XLogP | 2.50 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.88 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |