C15H21N3O4S — CID 124880624
methyl N-[4-[cyclopropyl-[(3S)-pyrrolidin-3-yl]sulfamoyl]phenyl]carbamate (PubChem CID 124880624) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is methyl N-[4-[cyclopropyl-[(3S)-pyrrolidin-3-yl]sulfamoyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[cyclopropyl-[(3S)-pyrrolidin-3-yl]sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 124880624 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl N-[4-[cyclopropyl-[(3S)-pyrrolidin-3-yl]sulfamoyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(S(=O)(=O)N(C2CC2)[C@H]2CCNC2)cc1 |
| InChI | InChI=1S/C15H21N3O4S/c1-22-15(19)17-11-2-6-14(7-3-11)23(20,21)18(12-4-5-12)13-8-9-16-10-13/h2-3,6-7,12-13,16H,4-5,8-10H2,1H3,(H,17,19)/t13-/m0/s1 |
| InChIKey | DCKKGVOJRUSYGP-ZDUSSCGKSA-N |
| XLogP | 1.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |