About methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate
methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate (PubChem CID 124881083) has the molecular formula C14H18F3N3O3
and a molecular weight of 333.31 g/mol. Its IUPAC name is methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate |
| PubChem CID | 124881083 |
| Molecular Formula | C14H18F3N3O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCN([C@@H](C)C(F)(F)F)CC2)[nH]1 |
| InChI | InChI=1S/C14H18F3N3O3/c1-9(14(15,16)17)19-5-7-20(8-6-19)12(21)10-3-4-11(18-10)13(22)23-2/h3-4,9,18H,5-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | ZPVXGJZQALRQNR-VIFPVBQESA-N |
| XLogP | 1.51 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate?
The IUPAC name of methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate (CID 124881083) is methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate.
What is the SMILES notation for methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate?
The canonical SMILES for methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate is COC(=O)c1ccc(C(=O)N2CCN([C@@H](C)C(F)(F)F)CC2)[nH]1.
What is the InChIKey of methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate?
The InChIKey is ZPVXGJZQALRQNR-VIFPVBQESA-N. The full InChI is InChI=1S/C14H18F3N3O3/c1-9(14(15,16)17)19-5-7-20(8-6-19)12(21)10-3-4-11(18-10)13(22)23-2/h3-4,9,18H,5-8H2,1-2H3/t9-/m0/s1.
What are the key properties of methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate?
methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate has a molecular weight of 333.31 g/mol, XLogP of 1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[4-[(2S)-1,1,1-trifluoropropan-2-yl]piperazine-1-carbonyl]-1H-pyrrole-2-carboxylate is sourced from PubChem (CID 124881083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).