C14H18FN5O2 — CID 124881194
(5R,9S)-9-[[(6-ethyl-5-fluoropyrimidin-4-yl)amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 124881194) has the molecular formula C14H18FN5O2 and a molecular weight of 307.33 g/mol. Its IUPAC name is (5R,9S)-9-[[(6-ethyl-5-fluoropyrimidin-4-yl)amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5R,9S)-9-[[(6-ethyl-5-fluoropyrimidin-4-yl)amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 124881194 |
| Molecular Formula | C14H18FN5O2 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (5R,9S)-9-[[(6-ethyl-5-fluoropyrimidin-4-yl)amino]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | CCc1ncnc(NC[C@@H]2CCC[C@@]23NC(=O)NC3=O)c1F |
| InChI | InChI=1S/C14H18FN5O2/c1-2-9-10(15)11(18-7-17-9)16-6-8-4-3-5-14(8)12(21)19-13(22)20-14/h7-8H,2-6H2,1H3,(H,16,17,18)(H2,19,20,21,22)/t8-,14+/m0/s1 |
| InChIKey | BSXXINTZHYKKBG-RMLUDKJBSA-N |
| XLogP | 0.97 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|