C15H23FN2O2 — CID 124881460
(3S)-N'-(4-fluoro-2-methoxyphenyl)-3,4,4-trimethylpentanehydrazide (PubChem CID 124881460) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is (3S)-N'-(4-fluoro-2-methoxyphenyl)-3,4,4-trimethylpentanehydrazide.
| Compound Name | (3S)-N'-(4-fluoro-2-methoxyphenyl)-3,4,4-trimethylpentanehydrazide |
|---|---|
| PubChem CID | 124881460 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (3S)-N'-(4-fluoro-2-methoxyphenyl)-3,4,4-trimethylpentanehydrazide |
| SMILES | COc1cc(F)ccc1NNC(=O)C[C@H](C)C(C)(C)C |
| InChI | InChI=1S/C15H23FN2O2/c1-10(15(2,3)4)8-14(19)18-17-12-7-6-11(16)9-13(12)20-5/h6-7,9-10,17H,8H2,1-5H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | NGSJBLHQYNVZLU-JTQLQIEISA-N |
| XLogP | 3.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|