About (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one
(2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one (PubChem CID 124881844) has the molecular formula C19H28N2OS
and a molecular weight of 332.51 g/mol. Its IUPAC name is (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one.
Molecular Properties
| Compound Name | (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one |
| PubChem CID | 124881844 |
| Molecular Formula | C19H28N2OS |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one |
| SMILES | CC[C@H](Sc1ccccc1)C(=O)N1C[C@H](N2CCCC2)C[C@H]1C |
| InChI | InChI=1S/C19H28N2OS/c1-3-18(23-17-9-5-4-6-10-17)19(22)21-14-16(13-15(21)2)20-11-7-8-12-20/h4-6,9-10,15-16,18H,3,7-8,11-14H2,1-2H3/t15-,16-,18+/m1/s1 |
| InChIKey | MAZIMXRLHJJTJY-NUJGCVRESA-N |
| XLogP | 3.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one?
The IUPAC name of (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one (CID 124881844) is (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one.
What is the SMILES notation for (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one?
The canonical SMILES for (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one is CC[C@H](Sc1ccccc1)C(=O)N1C[C@H](N2CCCC2)C[C@H]1C.
What is the InChIKey of (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one?
The InChIKey is MAZIMXRLHJJTJY-NUJGCVRESA-N. The full InChI is InChI=1S/C19H28N2OS/c1-3-18(23-17-9-5-4-6-10-17)19(22)21-14-16(13-15(21)2)20-11-7-8-12-20/h4-6,9-10,15-16,18H,3,7-8,11-14H2,1-2H3/t15-,16-,18+/m1/s1.
What are the key properties of (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one?
(2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one has a molecular weight of 332.51 g/mol, XLogP of 3.64, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(2R,4R)-2-methyl-4-pyrrolidin-1-ylpyrrolidin-1-yl]-2-phenylsulfanylbutan-1-one is sourced from PubChem (CID 124881844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).