C22H25ClFN3O3 — CID 124882165
N'-(4-chloro-3-fluorophenyl)-N-[[2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]methyl]oxamide (PubChem CID 124882165) has the molecular formula C22H25ClFN3O3 and a molecular weight of 433.91 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N-[[2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]methyl]oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N-[[2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 124882165 |
| Molecular Formula | C22H25ClFN3O3 |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N-[[2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]methyl]oxamide |
| SMILES | C[C@@H]1CN(Cc2ccccc2CNC(=O)C(=O)Nc2ccc(Cl)c(F)c2)C[C@@H](C)O1 |
| InChI | InChI=1S/C22H25ClFN3O3/c1-14-11-27(12-15(2)30-14)13-17-6-4-3-5-16(17)10-25-21(28)22(29)26-18-7-8-19(23)20(24)9-18/h3-9,14-15H,10-13H2,1-2H3,(H,25,28)(H,26,29)/t14-,15-/m1/s1 |
| InChIKey | NSBUMOZRVJKOTQ-HUUCEWRRSA-N |
| XLogP | 3.34 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|