C17H18N4O2S — CID 124882241
(5R)-3'-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione (PubChem CID 124882241) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is (5R)-3'-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione.
| Compound Name | (5R)-3'-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 124882241 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (5R)-3'-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]spiro[6,7,8,9-tetrahydrobenzo[7]annulene-5,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1nnc(CN2C(=O)N[C@@]3(CCCCc4ccccc43)C2=O)s1 |
| InChI | InChI=1S/C17H18N4O2S/c1-11-19-20-14(24-11)10-21-15(22)17(18-16(21)23)9-5-4-7-12-6-2-3-8-13(12)17/h2-3,6,8H,4-5,7,9-10H2,1H3,(H,18,23)/t17-/m1/s1 |
| InChIKey | HOHFHCQSXKLVPS-QGZVFWFLSA-N |
| XLogP | 2.52 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|