C16H22N4S2 — CID 124882253
2-[(3R)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]piperidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 124882253) has the molecular formula C16H22N4S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 2-[(3R)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]piperidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-[(3R)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]piperidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 124882253 |
| Molecular Formula | C16H22N4S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[(3R)-1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]piperidin-3-yl]-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | Cc1nnc(CN2CCC[C@@H](c3nc4c(s3)CCCC4)C2)s1 |
| InChI | InChI=1S/C16H22N4S2/c1-11-18-19-15(21-11)10-20-8-4-5-12(9-20)16-17-13-6-2-3-7-14(13)22-16/h12H,2-10H2,1H3/t12-/m1/s1 |
| InChIKey | LMVJKAJVIHCLDB-GFCCVEGCSA-N |
| XLogP | 3.56 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |