C19H20N6O — CID 124883211
2-phenyl-N-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]pyrazole-3-carboxamide (PubChem CID 124883211) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-phenyl-N-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]pyrazole-3-carboxamide.
| Compound Name | 2-phenyl-N-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 124883211 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-phenyl-N-[(3R)-1-pyridazin-3-ylpiperidin-3-yl]pyrazole-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCCN(c2cccnn2)C1)c1ccnn1-c1ccccc1 |
| InChI | InChI=1S/C19H20N6O/c26-19(17-10-12-21-25(17)16-7-2-1-3-8-16)22-15-6-5-13-24(14-15)18-9-4-11-20-23-18/h1-4,7-12,15H,5-6,13-14H2,(H,22,26)/t15-/m1/s1 |
| InChIKey | DCEJKPLHNYVNCY-OAHLLOKOSA-N |
| XLogP | 2.06 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |