C14H16F3N5O — CID 124884128
(R)-1H-imidazol-2-yl-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol (PubChem CID 124884128) has the molecular formula C14H16F3N5O and a molecular weight of 327.31 g/mol. Its IUPAC name is (R)-1H-imidazol-2-yl-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol.
| Compound Name | (R)-1H-imidazol-2-yl-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 124884128 |
| Molecular Formula | C14H16F3N5O |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (R)-1H-imidazol-2-yl-[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]methanol |
| SMILES | O[C@@H](c1ncc[nH]1)C1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C14H16F3N5O/c15-14(16,17)10-1-4-20-13(21-10)22-7-2-9(3-8-22)11(23)12-18-5-6-19-12/h1,4-6,9,11,23H,2-3,7-8H2,(H,18,19)/t11-/m1/s1 |
| InChIKey | WVQXICDIXPHFTB-LLVKDONJSA-N |
| XLogP | 2.17 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |