About [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate
[(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate (PubChem CID 124884520) has the molecular formula C14H18F2O5S
and a molecular weight of 336.36 g/mol. Its IUPAC name is [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate.
Molecular Properties
| Compound Name | [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate |
| PubChem CID | 124884520 |
| Molecular Formula | C14H18F2O5S |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate |
| SMILES | CO[C@H](C)CCOC(=O)Cc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H18F2O5S/c1-10(20-2)7-8-21-13(17)9-11-3-5-12(6-4-11)22(18,19)14(15)16/h3-6,10,14H,7-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | DMCADKVXENSIKP-SNVBAGLBSA-N |
| XLogP | 2.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate?
The IUPAC name of [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate (CID 124884520) is [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate.
What is the SMILES notation for [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate?
The canonical SMILES for [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate is CO[C@H](C)CCOC(=O)Cc1ccc(S(=O)(=O)C(F)F)cc1.
What is the InChIKey of [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate?
The InChIKey is DMCADKVXENSIKP-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H18F2O5S/c1-10(20-2)7-8-21-13(17)9-11-3-5-12(6-4-11)22(18,19)14(15)16/h3-6,10,14H,7-9H2,1-2H3/t10-/m1/s1.
What are the key properties of [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate?
[(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate has a molecular weight of 336.36 g/mol, XLogP of 2.19, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-3-methoxybutyl] 2-[4-(difluoromethylsulfonyl)phenyl]acetate is sourced from PubChem (CID 124884520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).