C14H24N4O3S — CID 124885146
4-[(3R)-1-(2-imidazol-1-ylethyl)piperidin-3-yl]sulfonylmorpholine (PubChem CID 124885146) has the molecular formula C14H24N4O3S and a molecular weight of 328.44 g/mol. Its IUPAC name is 4-[(3R)-1-(2-imidazol-1-ylethyl)piperidin-3-yl]sulfonylmorpholine.
| Compound Name | 4-[(3R)-1-(2-imidazol-1-ylethyl)piperidin-3-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 124885146 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 4-[(3R)-1-(2-imidazol-1-ylethyl)piperidin-3-yl]sulfonylmorpholine |
| SMILES | O=S(=O)([C@@H]1CCCN(CCn2ccnc2)C1)N1CCOCC1 |
| InChI | InChI=1S/C14H24N4O3S/c19-22(20,18-8-10-21-11-9-18)14-2-1-4-16(12-14)6-7-17-5-3-15-13-17/h3,5,13-14H,1-2,4,6-12H2/t14-/m1/s1 |
| InChIKey | OLOQMJLMCVXTSJ-CQSZACIVSA-N |
| XLogP | 0.01 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |