About 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one
6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one (PubChem CID 124885365) has the molecular formula C13H12Cl2N2O3
and a molecular weight of 315.16 g/mol. Its IUPAC name is 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one.
Molecular Properties
| Compound Name | 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one |
| PubChem CID | 124885365 |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one |
| SMILES | O=c1c2cc(Cl)cc(Cl)c2ncn1C[C@H]1COCCO1 |
| InChI | InChI=1S/C13H12Cl2N2O3/c14-8-3-10-12(11(15)4-8)16-7-17(13(10)18)5-9-6-19-1-2-20-9/h3-4,7,9H,1-2,5-6H2/t9-/m0/s1 |
| InChIKey | ONXONEKCWUNKKS-VIFPVBQESA-N |
| XLogP | 2.12 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one?
The IUPAC name of 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one (CID 124885365) is 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one.
What is the SMILES notation for 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one?
The canonical SMILES for 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one is O=c1c2cc(Cl)cc(Cl)c2ncn1C[C@H]1COCCO1.
What is the InChIKey of 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one?
The InChIKey is ONXONEKCWUNKKS-VIFPVBQESA-N. The full InChI is InChI=1S/C13H12Cl2N2O3/c14-8-3-10-12(11(15)4-8)16-7-17(13(10)18)5-9-6-19-1-2-20-9/h3-4,7,9H,1-2,5-6H2/t9-/m0/s1.
What are the key properties of 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one?
6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one has a molecular weight of 315.16 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-3-[[(2S)-1,4-dioxan-2-yl]methyl]quinazolin-4-one is sourced from PubChem (CID 124885365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).