C15H23N5O2S — CID 124885479
1-[(3R)-1-(1-methylpyrazol-3-yl)-2-oxopiperidin-3-yl]-3-[[(3S)-thiolan-3-yl]methyl]urea (PubChem CID 124885479) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-[(3R)-1-(1-methylpyrazol-3-yl)-2-oxopiperidin-3-yl]-3-[[(3S)-thiolan-3-yl]methyl]urea.
| Compound Name | 1-[(3R)-1-(1-methylpyrazol-3-yl)-2-oxopiperidin-3-yl]-3-[[(3S)-thiolan-3-yl]methyl]urea |
|---|---|
| PubChem CID | 124885479 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-[(3R)-1-(1-methylpyrazol-3-yl)-2-oxopiperidin-3-yl]-3-[[(3S)-thiolan-3-yl]methyl]urea |
| SMILES | Cn1ccc(N2CCC[C@@H](NC(=O)NC[C@@H]3CCSC3)C2=O)n1 |
| InChI | InChI=1S/C15H23N5O2S/c1-19-7-4-13(18-19)20-6-2-3-12(14(20)21)17-15(22)16-9-11-5-8-23-10-11/h4,7,11-12H,2-3,5-6,8-10H2,1H3,(H2,16,17,22)/t11-,12+/m0/s1 |
| InChIKey | GNAPMXNMOSSXPX-NWDGAFQWSA-N |
| XLogP | 0.97 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |