About 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone
1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone (PubChem CID 124886101) has the molecular formula C18H18FNO3S
and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone.
Molecular Properties
| Compound Name | 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone |
| PubChem CID | 124886101 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(C)(=O)=O)c(N[C@@H]2CCc3ccc(F)cc32)c1 |
| InChI | InChI=1S/C18H18FNO3S/c1-11(21)13-5-8-18(24(2,22)23)17(9-13)20-16-7-4-12-3-6-14(19)10-15(12)16/h3,5-6,8-10,16,20H,4,7H2,1-2H3/t16-/m1/s1 |
| InChIKey | NGQNYCSZGMLHGY-MRXNPFEDSA-N |
| XLogP | 3.53 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone?
The IUPAC name of 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone (CID 124886101) is 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone.
What is the SMILES notation for 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone?
The canonical SMILES for 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone is CC(=O)c1ccc(S(C)(=O)=O)c(N[C@@H]2CCc3ccc(F)cc32)c1.
What is the InChIKey of 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone?
The InChIKey is NGQNYCSZGMLHGY-MRXNPFEDSA-N. The full InChI is InChI=1S/C18H18FNO3S/c1-11(21)13-5-8-18(24(2,22)23)17(9-13)20-16-7-4-12-3-6-14(19)10-15(12)16/h3,5-6,8-10,16,20H,4,7H2,1-2H3/t16-/m1/s1.
What are the key properties of 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone?
1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone has a molecular weight of 347.41 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[[(1R)-6-fluoro-2,3-dihydro-1H-inden-1-yl]amino]-4-methylsulfonylphenyl]ethanone is sourced from PubChem (CID 124886101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).