About (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide
(2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide (PubChem CID 124886318) has the molecular formula C16H28N2O3
and a molecular weight of 296.41 g/mol. Its IUPAC name is (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide |
| PubChem CID | 124886318 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide |
| SMILES | C=CCOCCNC(=O)N1CCC[C@@H]1[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C16H28N2O3/c1-2-11-21-12-9-17-16(20)18-10-5-7-14(18)13-6-3-4-8-15(13)19/h2,13-15,19H,1,3-12H2,(H,17,20)/t13-,14+,15+/m0/s1 |
| InChIKey | FXVUOFQOYYHYTC-RRFJBIMHSA-N |
| XLogP | 1.91 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide?
The IUPAC name of (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide (CID 124886318) is (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide.
What is the SMILES notation for (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide?
The canonical SMILES for (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide is C=CCOCCNC(=O)N1CCC[C@@H]1[C@@H]1CCCC[C@H]1O.
What is the InChIKey of (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide?
The InChIKey is FXVUOFQOYYHYTC-RRFJBIMHSA-N. The full InChI is InChI=1S/C16H28N2O3/c1-2-11-21-12-9-17-16(20)18-10-5-7-14(18)13-6-3-4-8-15(13)19/h2,13-15,19H,1,3-12H2,(H,17,20)/t13-,14+,15+/m0/s1.
What are the key properties of (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide?
(2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide has a molecular weight of 296.41 g/mol, XLogP of 1.91, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1S,2R)-2-hydroxycyclohexyl]-N-(2-prop-2-enoxyethyl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 124886318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).