C12H16F3NO4S2 — CID 124886327
ethyl (3S)-4,4,4-trifluoro-3-(2-thiophen-2-ylethylsulfamoyl)butanoate (PubChem CID 124886327) has the molecular formula C12H16F3NO4S2 and a molecular weight of 359.39 g/mol. Its IUPAC name is ethyl (3S)-4,4,4-trifluoro-3-(2-thiophen-2-ylethylsulfamoyl)butanoate.
| Compound Name | ethyl (3S)-4,4,4-trifluoro-3-(2-thiophen-2-ylethylsulfamoyl)butanoate |
|---|---|
| PubChem CID | 124886327 |
| Molecular Formula | C12H16F3NO4S2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | ethyl (3S)-4,4,4-trifluoro-3-(2-thiophen-2-ylethylsulfamoyl)butanoate |
| SMILES | CCOC(=O)C[C@@H](C(F)(F)F)S(=O)(=O)NCCc1cccs1 |
| InChI | InChI=1S/C12H16F3NO4S2/c1-2-20-11(17)8-10(12(13,14)15)22(18,19)16-6-5-9-4-3-7-21-9/h3-4,7,10,16H,2,5-6,8H2,1H3/t10-/m0/s1 |
| InChIKey | FZPSEVDJVZJGRL-JTQLQIEISA-N |
| XLogP | 2.09 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |