C15H26FN3O2 — CID 124886345
4-[(2R)-3-cyclohexyl-2-fluoropropanoyl]-1,4-diazepane-1-carboxamide (PubChem CID 124886345) has the molecular formula C15H26FN3O2 and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-[(2R)-3-cyclohexyl-2-fluoropropanoyl]-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[(2R)-3-cyclohexyl-2-fluoropropanoyl]-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 124886345 |
| Molecular Formula | C15H26FN3O2 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 4-[(2R)-3-cyclohexyl-2-fluoropropanoyl]-1,4-diazepane-1-carboxamide |
| SMILES | NC(=O)N1CCCN(C(=O)[C@H](F)CC2CCCCC2)CC1 |
| InChI | InChI=1S/C15H26FN3O2/c16-13(11-12-5-2-1-3-6-12)14(20)18-7-4-8-19(10-9-18)15(17)21/h12-13H,1-11H2,(H2,17,21)/t13-/m1/s1 |
| InChIKey | CTUWWEOWJUPFGX-CYBMUJFWSA-N |
| XLogP | 1.91 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |