C13H20N6S — CID 124886552
3-ethyl-5-[(8S)-8-methyl-3-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1,2,4-thiadiazole (PubChem CID 124886552) has the molecular formula C13H20N6S and a molecular weight of 292.41 g/mol. Its IUPAC name is 3-ethyl-5-[(8S)-8-methyl-3-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1,2,4-thiadiazole.
| Compound Name | 3-ethyl-5-[(8S)-8-methyl-3-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 124886552 |
| Molecular Formula | C13H20N6S |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3-ethyl-5-[(8S)-8-methyl-3-propan-2-yl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-1,2,4-thiadiazole |
| SMILES | CCc1nsc(N2CCn3c(C(C)C)nnc3[C@@H]2C)n1 |
| InChI | InChI=1S/C13H20N6S/c1-5-10-14-13(20-17-10)18-6-7-19-11(8(2)3)15-16-12(19)9(18)4/h8-9H,5-7H2,1-4H3/t9-/m0/s1 |
| InChIKey | OIFSWJQKXHLGED-VIFPVBQESA-N |
| XLogP | 2.40 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |