C18H17ClN4O2 — CID 124886715
6-chloro-2-[(2S)-1-[(4-nitrophenyl)methyl]pyrrolidin-2-yl]-1H-benzimidazole (PubChem CID 124886715) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 6-chloro-2-[(2S)-1-[(4-nitrophenyl)methyl]pyrrolidin-2-yl]-1H-benzimidazole.
| Compound Name | 6-chloro-2-[(2S)-1-[(4-nitrophenyl)methyl]pyrrolidin-2-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 124886715 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 6-chloro-2-[(2S)-1-[(4-nitrophenyl)methyl]pyrrolidin-2-yl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(CN2CCC[C@H]2c2nc3ccc(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C18H17ClN4O2/c19-13-5-8-15-16(10-13)21-18(20-15)17-2-1-9-22(17)11-12-3-6-14(7-4-12)23(24)25/h3-8,10,17H,1-2,9,11H2,(H,20,21)/t17-/m0/s1 |
| InChIKey | IEMSPSPSVHSUIY-KRWDZBQOSA-N |
| XLogP | 4.46 |
| TPSA | 75.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|