C13H16N4O2S — CID 124886744
N-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]-5-methyl-3-nitropyridin-2-amine (PubChem CID 124886744) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]-5-methyl-3-nitropyridin-2-amine.
| Compound Name | N-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]-5-methyl-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 124886744 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-[(1S)-1-(2-ethyl-1,3-thiazol-4-yl)ethyl]-5-methyl-3-nitropyridin-2-amine |
| SMILES | CCc1nc([C@H](C)Nc2ncc(C)cc2[N+](=O)[O-])cs1 |
| InChI | InChI=1S/C13H16N4O2S/c1-4-12-16-10(7-20-12)9(3)15-13-11(17(18)19)5-8(2)6-14-13/h5-7,9H,4H2,1-3H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | HYFAIKDOVDXIQA-VIFPVBQESA-N |
| XLogP | 3.49 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|