C16H23N3O2S — CID 124887115
N-[(1S,3R)-1-oxothiolan-3-yl]-4-phenyl-1,4-diazepane-1-carboxamide (PubChem CID 124887115) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is N-[(1S,3R)-1-oxothiolan-3-yl]-4-phenyl-1,4-diazepane-1-carboxamide.
| Compound Name | N-[(1S,3R)-1-oxothiolan-3-yl]-4-phenyl-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 124887115 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[(1S,3R)-1-oxothiolan-3-yl]-4-phenyl-1,4-diazepane-1-carboxamide |
| SMILES | O=C(N[C@@H]1CC[S@@](=O)C1)N1CCCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H23N3O2S/c20-16(17-14-7-12-22(21)13-14)19-9-4-8-18(10-11-19)15-5-2-1-3-6-15/h1-3,5-6,14H,4,7-13H2,(H,17,20)/t14-,22-/m1/s1 |
| InChIKey | KBOGTPJKKFCAIN-JLCFBVMHSA-N |
| XLogP | 1.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |